C18H31IN4O4 — CID 110914487
2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 110914487) has the molecular formula C18H31IN4O4 and a molecular weight of 494.37 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110914487 |
| Molecular Formula | C18H31IN4O4 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/CC(c1ccc(OC)c(OC)c1)N1CCOCC1.I |
| InChI | InChI=1S/C18H30N4O4.HI/c1-23-9-6-20-18(19)21-13-15(22-7-10-26-11-8-22)14-4-5-16(24-2)17(12-14)25-3;/h4-5,12,15H,6-11,13H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | RMNZYQAHDNSWQG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|