C22H29ClN4O2 — CID 110926379
2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine (PubChem CID 110926379) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110926379 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(4-methoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/CC(c2ccc(Cl)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29ClN4O2/c1-28-20-8-2-17(3-9-20)10-11-25-22(24)26-16-21(27-12-14-29-15-13-27)18-4-6-19(23)7-5-18/h2-9,21H,10-16H2,1H3,(H3,24,25,26) |
| InChIKey | JQGPWIUCTMSPLF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|