C23H31ClN4O3 — CID 111054735
2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine (PubChem CID 111054735) has the molecular formula C23H31ClN4O3 and a molecular weight of 446.98 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111054735 |
| Molecular Formula | C23H31ClN4O3 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/CC(c2ccccc2Cl)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H31ClN4O3/c1-29-21-8-7-17(15-22(21)30-2)9-10-26-23(25)27-16-20(28-11-13-31-14-12-28)18-5-3-4-6-19(18)24/h3-8,15,20H,9-14,16H2,1-2H3,(H3,25,26,27) |
| InChIKey | SYBODSRGKWFNIC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|