C13H19ClN4O — CID 110914972
2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]guanidine (PubChem CID 110914972) has the molecular formula C13H19ClN4O and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]guanidine.
| Compound Name | 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 110914972 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]guanidine |
| SMILES | NC(N)=NCC(c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C13H19ClN4O/c14-11-4-2-1-3-10(11)12(9-17-13(15)16)18-5-7-19-8-6-18/h1-4,12H,5-9H2,(H4,15,16,17) |
| InChIKey | AUXHPENWKPAHSG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|