C17H27ClN4O2 — CID 111054785
2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1-methoxypropan-2-yl)guanidine (PubChem CID 111054785) has the molecular formula C17H27ClN4O2 and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 111054785 |
| Molecular Formula | C17H27ClN4O2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-1-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)N/C(N)=N/CC(c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C17H27ClN4O2/c1-13(12-23-2)21-17(19)20-11-16(22-7-9-24-10-8-22)14-5-3-4-6-15(14)18/h3-6,13,16H,7-12H2,1-2H3,(H3,19,20,21) |
| InChIKey | LCCANWRGPJWQNR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|