C20H27N3O3 — CID 111082503
2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111082503) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111082503 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | Cc1cccc(OCC(O)C/N=C(\N)Nc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-14(2)26-18-9-7-16(8-10-18)23-20(21)22-12-17(24)13-25-19-6-4-5-15(3)11-19/h4-11,14,17,24H,12-13H2,1-3H3,(H3,21,22,23) |
| InChIKey | HPPXRIRMURWLQD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|