C17H30IN3O3 — CID 111061464
2-[2-hydroxy-3-(2-methylpropoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111061464) has the molecular formula C17H30IN3O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(2-methylpropoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-hydroxy-3-(2-methylpropoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111061464 |
| Molecular Formula | C17H30IN3O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-[2-hydroxy-3-(2-methylpropoxy)propyl]-1-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)COCC(O)C/N=C(\N)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C17H29N3O3.HI/c1-12(2)10-22-11-15(21)9-19-17(18)20-14-5-7-16(8-6-14)23-13(3)4;/h5-8,12-13,15,21H,9-11H2,1-4H3,(H3,18,19,20);1H |
| InChIKey | GPTFIMWVQHHPBG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|