C18H23I2N3O2 — CID 111097338
1-(4-ethylphenyl)-2-[2-hydroxy-3-(4-iodophenoxy)propyl]guanidine;hydroiodide (PubChem CID 111097338) has the molecular formula C18H23I2N3O2 and a molecular weight of 567.21 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-[2-hydroxy-3-(4-iodophenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(4-ethylphenyl)-2-[2-hydroxy-3-(4-iodophenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111097338 |
| Molecular Formula | C18H23I2N3O2 |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 566.99 |
| IUPAC Name | 1-(4-ethylphenyl)-2-[2-hydroxy-3-(4-iodophenoxy)propyl]guanidine;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/CC(O)COc2ccc(I)cc2)cc1.I |
| InChI | InChI=1S/C18H22IN3O2.HI/c1-2-13-3-7-15(8-4-13)22-18(20)21-11-16(23)12-24-17-9-5-14(19)6-10-17;/h3-10,16,23H,2,11-12H2,1H3,(H3,20,21,22);1H |
| InChIKey | BUVQRIGSZYRSBA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|