C23H25N3O3 — CID 111599592
2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(3-phenoxyphenyl)guanidine (PubChem CID 111599592) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(3-phenoxyphenyl)guanidine.
| Compound Name | 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(3-phenoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111599592 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(3-phenoxyphenyl)guanidine |
| SMILES | Cc1cccc(OCC(O)C/N=C(\N)Nc2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-17-7-5-11-21(13-17)28-16-19(27)15-25-23(24)26-18-8-6-12-22(14-18)29-20-9-3-2-4-10-20/h2-14,19,27H,15-16H2,1H3,(H3,24,25,26) |
| InChIKey | JBUYMMZTSZSCRM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|