C15H24IN3O2 — CID 136921177
2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 136921177) has the molecular formula C15H24IN3O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 136921177 |
| Molecular Formula | C15H24IN3O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[2-hydroxy-3-(3-methylphenoxy)propyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(N)=N/CC(O)COc1cccc(C)c1.I |
| InChI | InChI=1S/C15H23N3O2.HI/c1-11(2)8-17-15(16)18-9-13(19)10-20-14-6-4-5-12(3)7-14;/h4-7,13,19H,1,8-10H2,2-3H3,(H3,16,17,18);1H |
| InChIKey | IFZVNDKVIHAFMS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|