C15H19IN4O3S — CID 111598315
1-(3-phenoxyphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111598315) has the molecular formula C15H19IN4O3S and a molecular weight of 462.31 g/mol. Its IUPAC name is 1-(3-phenoxyphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-phenoxyphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598315 |
| Molecular Formula | C15H19IN4O3S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 1-(3-phenoxyphenyl)-2-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCS(N)(=O)=O)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H18N4O3S.HI/c16-15(18-9-10-23(17,20)21)19-12-5-4-8-14(11-12)22-13-6-2-1-3-7-13;/h1-8,11H,9-10H2,(H3,16,18,19)(H2,17,20,21);1H |
| InChIKey | LFQOBOJIPJMREC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|