C20H25IN4O2 — CID 111599045
4-[[amino-(3-phenoxyanilino)methylidene]amino]-N-cyclopropylbutanamide;hydroiodide (PubChem CID 111599045) has the molecular formula C20H25IN4O2 and a molecular weight of 480.35 g/mol. Its IUPAC name is 4-[[amino-(3-phenoxyanilino)methylidene]amino]-N-cyclopropylbutanamide;hydroiodide.
| Compound Name | 4-[[amino-(3-phenoxyanilino)methylidene]amino]-N-cyclopropylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111599045 |
| Molecular Formula | C20H25IN4O2 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 4-[[amino-(3-phenoxyanilino)methylidene]amino]-N-cyclopropylbutanamide;hydroiodide |
| SMILES | I.N/C(=N\CCCC(=O)NC1CC1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H24N4O2.HI/c21-20(22-13-5-10-19(25)23-15-11-12-15)24-16-6-4-9-18(14-16)26-17-7-2-1-3-8-17;/h1-4,6-9,14-15H,5,10-13H2,(H,23,25)(H3,21,22,24);1H |
| InChIKey | BBZJSDQIEYINGV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|