C15H16F3N3O3 — CID 111819956
2-[2-(furan-2-yl)-2-hydroxypropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111819956) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111819956 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | CC(O)(C/N=C(\N)Nc1ccc(OC(F)(F)F)cc1)c1ccco1 |
| InChI | InChI=1S/C15H16F3N3O3/c1-14(22,12-3-2-8-23-12)9-20-13(19)21-10-4-6-11(7-5-10)24-15(16,17)18/h2-8,22H,9H2,1H3,(H3,19,20,21) |
| InChIKey | XVOYRBPJQZPFSC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|