C15H20IN3O2 — CID 111819927
2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-methylphenyl)guanidine;hydroiodide (PubChem CID 111819927) has the molecular formula C15H20IN3O2 and a molecular weight of 401.25 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-methylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-methylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111819927 |
| Molecular Formula | C15H20IN3O2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-methylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CC(C)(O)c2ccco2)c1.I |
| InChI | InChI=1S/C15H19N3O2.HI/c1-11-5-3-6-12(9-11)18-14(16)17-10-15(2,19)13-7-4-8-20-13;/h3-9,19H,10H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | PEJXNOPGLJGTNV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|