C16H29N3O2 — CID 111819960
2-[2-(furan-2-yl)-2-hydroxypropyl]-1-octylguanidine (PubChem CID 111819960) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-octylguanidine.
| Compound Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-octylguanidine |
|---|---|
| PubChem CID | 111819960 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-octylguanidine |
| SMILES | CCCCCCCCN/C(N)=N/CC(C)(O)c1ccco1 |
| InChI | InChI=1S/C16H29N3O2/c1-3-4-5-6-7-8-11-18-15(17)19-13-16(2,20)14-10-9-12-21-14/h9-10,12,20H,3-8,11,13H2,1-2H3,(H3,17,18,19) |
| InChIKey | NOECMBKWTIDZLF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|