C12H20IN3O2 — CID 111672065
2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111672065) has the molecular formula C12H20IN3O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672065 |
| Molecular Formula | C12H20IN3O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(N)=N/CC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C12H19N3O2.HI/c1-9(2)7-14-11(13)15-8-12(3,16)10-5-4-6-17-10;/h4-6,16H,1,7-8H2,2-3H3,(H3,13,14,15);1H |
| InChIKey | ULUZTDQEAVFJEJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|