C12H19ClIN3O2 — CID 119156939
1-(2-chloroprop-2-enyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide (PubChem CID 119156939) has the molecular formula C12H19ClIN3O2 and a molecular weight of 399.66 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-chloroprop-2-enyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119156939 |
| Molecular Formula | C12H19ClIN3O2 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 1-(2-chloroprop-2-enyl)-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-methylguanidine;hydroiodide |
| SMILES | C=C(Cl)CN/C(=N\C)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C12H18ClN3O2.HI/c1-9(13)7-15-11(14-3)16-8-12(2,17)10-5-4-6-18-10;/h4-6,17H,1,7-8H2,2-3H3,(H2,14,15,16);1H |
| InChIKey | UJZWHBCVWUMEND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|