C14H20IN3O3 — CID 119141862
1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 119141862) has the molecular formula C14H20IN3O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119141862 |
| Molecular Formula | C14H20IN3O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccoc1)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C14H19N3O3.HI/c1-14(18,12-4-3-6-20-12)10-17-13(15-2)16-8-11-5-7-19-9-11;/h3-7,9,18H,8,10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | RMYHMMUJRPSWFR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|