C12H15BrIN3OS — CID 119151262
1-[(4-bromothiophen-2-yl)methyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 119151262) has the molecular formula C12H15BrIN3OS and a molecular weight of 456.15 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119151262 |
| Molecular Formula | C12H15BrIN3OS |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 454.92 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-(furan-3-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccoc1)NCc1cc(Br)cs1.I |
| InChI | InChI=1S/C12H14BrN3OS.HI/c1-14-12(15-5-9-2-3-17-7-9)16-6-11-4-10(13)8-18-11;/h2-4,7-8H,5-6H2,1H3,(H2,14,15,16);1H |
| InChIKey | QSKOBWNFXLYYKB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|