C12H20BrN3S — CID 111002485
1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine (PubChem CID 111002485) has the molecular formula C12H20BrN3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 111002485 |
| Molecular Formula | C12H20BrN3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-2-methyl-3-(3-methylbutan-2-yl)guanidine |
| SMILES | C/N=C(/NCc1cc(Br)cs1)NC(C)C(C)C |
| InChI | InChI=1S/C12H20BrN3S/c1-8(2)9(3)16-12(14-4)15-6-11-5-10(13)7-17-11/h5,7-9H,6H2,1-4H3,(H2,14,15,16) |
| InChIKey | LQUNGAPTAXKMAX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|