C17H23N3O2 — CID 111819934
2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-propan-2-ylphenyl)guanidine (PubChem CID 111819934) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-propan-2-ylphenyl)guanidine.
| Compound Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-propan-2-ylphenyl)guanidine |
|---|---|
| PubChem CID | 111819934 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-hydroxypropyl]-1-(3-propan-2-ylphenyl)guanidine |
| SMILES | CC(C)c1cccc(N/C(N)=N/CC(C)(O)c2ccco2)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-12(2)13-6-4-7-14(10-13)20-16(18)19-11-17(3,21)15-8-5-9-22-15/h4-10,12,21H,11H2,1-3H3,(H3,18,19,20) |
| InChIKey | RGLZQNHTTGDSIL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|