C12H21N3O — CID 110914351
2-(furan-2-ylmethyl)-1-hexylguanidine (PubChem CID 110914351) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1-hexylguanidine.
| Compound Name | 2-(furan-2-ylmethyl)-1-hexylguanidine |
|---|---|
| PubChem CID | 110914351 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1-hexylguanidine |
| SMILES | CCCCCCN/C(N)=N/Cc1ccco1 |
| InChI | InChI=1S/C12H21N3O/c1-2-3-4-5-8-14-12(13)15-10-11-7-6-9-16-11/h6-7,9H,2-5,8,10H2,1H3,(H3,13,14,15) |
| InChIKey | NEUGBNPFYGSKRA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|