C16H26F2IN3O — CID 111823786
2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide (PubChem CID 111823786) has the molecular formula C16H26F2IN3O and a molecular weight of 441.30 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide.
| Compound Name | 2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111823786 |
| Molecular Formula | C16H26F2IN3O |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-1-hexylguanidine;hydroiodide |
| SMILES | CCCCCCN/C(N)=N/CC(C)(O)c1ccc(F)cc1F.I |
| InChI | InChI=1S/C16H25F2N3O.HI/c1-3-4-5-6-9-20-15(19)21-11-16(2,22)13-8-7-12(17)10-14(13)18;/h7-8,10,22H,3-6,9,11H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | YIBHTYBZIZXQCO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|