C14H21F2N3O — CID 111823785
1-tert-butyl-2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]guanidine (PubChem CID 111823785) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 111823785 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-tert-butyl-2-[2-(2,4-difluorophenyl)-2-hydroxypropyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CC(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2N3O/c1-13(2,3)19-12(17)18-8-14(4,20)10-6-5-9(15)7-11(10)16/h5-7,20H,8H2,1-4H3,(H3,17,18,19) |
| InChIKey | MSSLQQHEIVOMHZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|