C14H23ClIN3O — CID 110061971
1-tert-butyl-2-[2-(2-chlorophenyl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 110061971) has the molecular formula C14H23ClIN3O and a molecular weight of 411.72 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(2-chlorophenyl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[2-(2-chlorophenyl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110061971 |
| Molecular Formula | C14H23ClIN3O |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-tert-butyl-2-[2-(2-chlorophenyl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CC(C)(C)N/C(N)=N/CC(C)(O)c1ccccc1Cl.I |
| InChI | InChI=1S/C14H22ClN3O.HI/c1-13(2,3)18-12(16)17-9-14(4,19)10-7-5-6-8-11(10)15;/h5-8,19H,9H2,1-4H3,(H3,16,17,18);1H |
| InChIKey | JANOMOITEHITKN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|