C14H23ClIN3O — CID 110061985
2-[2-(2-chlorophenyl)-2-hydroxypropyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 110061985) has the molecular formula C14H23ClIN3O and a molecular weight of 411.72 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxypropyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxypropyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110061985 |
| Molecular Formula | C14H23ClIN3O |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxypropyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCC(C)(O)c1ccccc1Cl)N(C)C.I |
| InChI | InChI=1S/C14H22ClN3O.HI/c1-14(19,11-8-6-7-9-12(11)15)10-16-13(17(2)3)18(4)5;/h6-9,19H,10H2,1-5H3;1H |
| InChIKey | GWBDFCWYXRDFNE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|