C19H34IN3O2 — CID 111805199
2-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-1-hexylguanidine;hydroiodide (PubChem CID 111805199) has the molecular formula C19H34IN3O2 and a molecular weight of 463.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-1-hexylguanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-1-hexylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111805199 |
| Molecular Formula | C19H34IN3O2 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-1-hexylguanidine;hydroiodide |
| SMILES | CCCCCCN/C(N)=N/CC(C)(C)c1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C19H33N3O2.HI/c1-6-7-8-9-12-21-18(20)22-14-19(2,3)15-10-11-16(23-4)17(13-15)24-5;/h10-11,13H,6-9,12,14H2,1-5H3,(H3,20,21,22);1H |
| InChIKey | NRGPYNJUWZYZNE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|