C21H29FIN3O2 — CID 111816345
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111816345) has the molecular formula C21H29FIN3O2 and a molecular weight of 501.38 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111816345 |
| Molecular Formula | C21H29FIN3O2 |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC(C)(C)c2cccc(F)c2)cc1OC.I |
| InChI | InChI=1S/C21H28FN3O2.HI/c1-21(2,16-6-5-7-17(22)13-16)14-25-20(23)24-11-10-15-8-9-18(26-3)19(12-15)27-4;/h5-9,12-13H,10-11,14H2,1-4H3,(H3,23,24,25);1H |
| InChIKey | SXIVQAXQPCDGJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|