C22H32IN3O2 — CID 111087975
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-2-(2-methylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111087975) has the molecular formula C22H32IN3O2 and a molecular weight of 497.42 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-2-(2-methylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-2-(2-methylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111087975 |
| Molecular Formula | C22H32IN3O2 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-methyl-2-(2-methylphenyl)propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CC(C)(C)c2ccccc2C)cc1OC.I |
| InChI | InChI=1S/C22H31N3O2.HI/c1-16-8-6-7-9-18(16)22(2,3)15-25-21(23)24-13-12-17-10-11-19(26-4)20(14-17)27-5;/h6-11,14H,12-13,15H2,1-5H3,(H3,23,24,25);1H |
| InChIKey | VFHLEKJJIBDMBS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|