C20H27N3O3 — CID 111036916
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-phenoxypropyl)guanidine (PubChem CID 111036916) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-phenoxypropyl)guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-phenoxypropyl)guanidine |
|---|---|
| PubChem CID | 111036916 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-phenoxypropyl)guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/CCCOc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H27N3O3/c1-24-18-10-9-16(15-19(18)25-2)11-13-23-20(21)22-12-6-14-26-17-7-4-3-5-8-17/h3-5,7-10,15H,6,11-14H2,1-2H3,(H3,21,22,23) |
| InChIKey | GGFVLJADBXOKSN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|