C17H30IN3O3 — CID 111026113
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-propan-2-yloxypropyl)guanidine;hydroiodide (PubChem CID 111026113) has the molecular formula C17H30IN3O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-propan-2-yloxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-propan-2-yloxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111026113 |
| Molecular Formula | C17H30IN3O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-propan-2-yloxypropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CCCOC(C)C)cc1OC.I |
| InChI | InChI=1S/C17H29N3O3.HI/c1-13(2)23-11-5-9-19-17(18)20-10-8-14-6-7-15(21-3)16(12-14)22-4;/h6-7,12-13H,5,8-11H2,1-4H3,(H3,18,19,20);1H |
| InChIKey | HHNXPHCTJJXSBE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|