C23H28IN3O2 — CID 111069787
2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-naphthalen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111069787) has the molecular formula C23H28IN3O2 and a molecular weight of 505.40 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-naphthalen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-naphthalen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111069787 |
| Molecular Formula | C23H28IN3O2 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-naphthalen-2-ylethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(CC/N=C(\N)NCCc2ccc3ccccc3c2)cc1OC.I |
| InChI | InChI=1S/C23H27N3O2.HI/c1-27-21-10-8-18(16-22(21)28-2)12-14-26-23(24)25-13-11-17-7-9-19-5-3-4-6-20(19)15-17;/h3-10,15-16H,11-14H2,1-2H3,(H3,24,25,26);1H |
| InChIKey | DOWZYKRGPMLZSE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|