C19H24ClN3O2 — CID 111044372
2-[2-(2-chlorophenyl)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine (PubChem CID 111044372) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(2-chlorophenyl)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111044372 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[2-(2-chlorophenyl)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
| SMILES | COc1ccc(CCN/C(N)=N/CCc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C19H24ClN3O2/c1-24-17-8-7-14(13-18(17)25-2)9-11-22-19(21)23-12-10-15-5-3-4-6-16(15)20/h3-8,13H,9-12H2,1-2H3,(H3,21,22,23) |
| InChIKey | TYGXIOGFTHEGQY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|