C21H27IN4O2 — CID 111024611
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111024611) has the molecular formula C21H27IN4O2 and a molecular weight of 494.38 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111024611 |
| Molecular Formula | C21H27IN4O2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CCc2c[nH]c3ccccc23)cc1OC.I |
| InChI | InChI=1S/C21H26N4O2.HI/c1-26-19-8-7-15(13-20(19)27-2)9-11-23-21(22)24-12-10-16-14-25-18-6-4-3-5-17(16)18;/h3-8,13-14,25H,9-12H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | KOQFTIIATVUNAT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|