C22H29IN4O2 — CID 111807075
2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(7-ethyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111807075) has the molecular formula C22H29IN4O2 and a molecular weight of 508.40 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(7-ethyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(7-ethyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807075 |
| Molecular Formula | C22H29IN4O2 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[2-(7-ethyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCc1cccc2c(CCN/C(N)=N/Cc3ccc(OC)c(OC)c3)c[nH]c12.I |
| InChI | InChI=1S/C22H28N4O2.HI/c1-4-16-6-5-7-18-17(14-25-21(16)18)10-11-24-22(23)26-13-15-8-9-19(27-2)20(12-15)28-3;/h5-9,12,14,25H,4,10-11,13H2,1-3H3,(H3,23,24,26);1H |
| InChIKey | SMASSHDIJJZTDC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|