C15H23IN4O — CID 111108916
2-[3-(1H-indol-3-yl)propyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 111108916) has the molecular formula C15H23IN4O and a molecular weight of 402.28 g/mol. Its IUPAC name is 2-[3-(1H-indol-3-yl)propyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(1H-indol-3-yl)propyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111108916 |
| Molecular Formula | C15H23IN4O |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[3-(1H-indol-3-yl)propyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/CCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C15H22N4O.HI/c1-20-10-9-18-15(16)17-8-4-5-12-11-19-14-7-3-2-6-13(12)14;/h2-3,6-7,11,19H,4-5,8-10H2,1H3,(H3,16,17,18);1H |
| InChIKey | VXTRYMDAXORPFH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|