C20H24N4 — CID 111806426
1-(3-ethylphenyl)-2-[3-(1H-indol-3-yl)propyl]guanidine (PubChem CID 111806426) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[3-(1H-indol-3-yl)propyl]guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-[3-(1H-indol-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111806426 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[3-(1H-indol-3-yl)propyl]guanidine |
| SMILES | CCc1cccc(N/C(N)=N/CCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C20H24N4/c1-2-15-7-5-9-17(13-15)24-20(21)22-12-6-8-16-14-23-19-11-4-3-10-18(16)19/h3-5,7,9-11,13-14,23H,2,6,8,12H2,1H3,(H3,21,22,24) |
| InChIKey | HOMINILYVCFDMO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|