C19H22N4 — CID 111806458
2-[3-(1H-indol-3-yl)propyl]-1-(4-methylphenyl)guanidine (PubChem CID 111806458) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[3-(1H-indol-3-yl)propyl]-1-(4-methylphenyl)guanidine.
| Compound Name | 2-[3-(1H-indol-3-yl)propyl]-1-(4-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111806458 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[3-(1H-indol-3-yl)propyl]-1-(4-methylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H22N4/c1-14-8-10-16(11-9-14)23-19(20)21-12-4-5-15-13-22-18-7-3-2-6-17(15)18/h2-3,6-11,13,22H,4-5,12H2,1H3,(H3,20,21,23) |
| InChIKey | FXYHAKMIOQDGTH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|