C25H30N6 — CID 69151289
2-[4-(1H-indol-3-yl)butyl]-1-[4-(1H-indol-3-yl)butylideneamino]guanidine (PubChem CID 69151289) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is 2-[4-(1H-indol-3-yl)butyl]-1-[4-(1H-indol-3-yl)butylideneamino]guanidine.
| Compound Name | 2-[4-(1H-indol-3-yl)butyl]-1-[4-(1H-indol-3-yl)butylideneamino]guanidine |
|---|---|
| PubChem CID | 69151289 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 2-[4-(1H-indol-3-yl)butyl]-1-[4-(1H-indol-3-yl)butylideneamino]guanidine |
| SMILES | N/C(=N\CCCCc1c[nH]c2ccccc12)NN=CCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H30N6/c26-25(27-15-7-5-9-19-17-28-23-13-3-1-11-21(19)23)31-30-16-8-6-10-20-18-29-24-14-4-2-12-22(20)24/h1-4,11-14,16-18,28-29H,5-10,15H2,(H3,26,27,31) |
| InChIKey | MRLZTNWZNYWRKK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|