C19H22N4 — CID 111024605
1-(3,4-dimethylphenyl)-2-[2-(1H-indol-3-yl)ethyl]guanidine (PubChem CID 111024605) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[2-(1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[2-(1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111024605 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[2-(1H-indol-3-yl)ethyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCc2c[nH]c3ccccc23)cc1C |
| InChI | InChI=1S/C19H22N4/c1-13-7-8-16(11-14(13)2)23-19(20)21-10-9-15-12-22-18-6-4-3-5-17(15)18/h3-8,11-12,22H,9-10H2,1-2H3,(H3,20,21,23) |
| InChIKey | XZJVXQGKUGRWHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|