C11H19N3OS — CID 111823877
2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-propylguanidine (PubChem CID 111823877) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-propylguanidine.
| Compound Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-propylguanidine |
|---|---|
| PubChem CID | 111823877 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-propylguanidine |
| SMILES | CCCN/C(N)=N/CC(C)(O)c1cccs1 |
| InChI | InChI=1S/C11H19N3OS/c1-3-6-13-10(12)14-8-11(2,15)9-5-4-7-16-9/h4-5,7,15H,3,6,8H2,1-2H3,(H3,12,13,14) |
| InChIKey | GJTWLXPTSYKWKI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|