C16H29N3OS — CID 111823821
2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(6-methylheptan-2-yl)guanidine (PubChem CID 111823821) has the molecular formula C16H29N3OS and a molecular weight of 311.50 g/mol. Its IUPAC name is 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(6-methylheptan-2-yl)guanidine.
| Compound Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111823821 |
| Molecular Formula | C16H29N3OS |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(6-methylheptan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CC(C)(O)c1cccs1 |
| InChI | InChI=1S/C16H29N3OS/c1-12(2)7-5-8-13(3)19-15(17)18-11-16(4,20)14-9-6-10-21-14/h6,9-10,12-13,20H,5,7-8,11H2,1-4H3,(H3,17,18,19) |
| InChIKey | BNGQUVOMSWVXQI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|