C14H23N3OS — CID 111823807
N'-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylpiperidine-1-carboximidamide (PubChem CID 111823807) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is N'-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111823807 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N'-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CC(C)(O)c2cccs2)C1 |
| InChI | InChI=1S/C14H23N3OS/c1-11-5-3-7-17(9-11)13(15)16-10-14(2,18)12-6-4-8-19-12/h4,6,8,11,18H,3,5,7,9-10H2,1-2H3,(H2,15,16) |
| InChIKey | KGJYHZUWKYFMAG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|