C16H22N6OS — CID 119148458
N'-(2-hydroxy-2-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119148458) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N'-(2-hydroxy-2-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-(2-hydroxy-2-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119148458 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N'-(2-hydroxy-2-thiophen-2-ylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CC(O)(C/N=C(\N)N1CCN(c2ncccn2)CC1)c1cccs1 |
| InChI | InChI=1S/C16H22N6OS/c1-16(23,13-4-2-11-24-13)12-20-14(17)21-7-9-22(10-8-21)15-18-5-3-6-19-15/h2-6,11,23H,7-10,12H2,1H3,(H2,17,20) |
| InChIKey | UCZGSAQNPLPPJX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|