C18H25IN6S — CID 119148330
N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 119148330) has the molecular formula C18H25IN6S and a molecular weight of 484.41 g/mol. Its IUPAC name is N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119148330 |
| Molecular Formula | C18H25IN6S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(C/N=C(\N)N1CCN(c2ncccn2)CC1)Sc1ccccc1.I |
| InChI | InChI=1S/C18H24N6S.HI/c1-15(25-16-6-3-2-4-7-16)14-22-17(19)23-10-12-24(13-11-23)18-20-8-5-9-21-18;/h2-9,15H,10-14H2,1H3,(H2,19,22);1H |
| InChIKey | VIBVSPCXIOGOMC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|