C20H28N6S — CID 111496108
N-ethyl-N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111496108) has the molecular formula C20H28N6S and a molecular weight of 384.55 g/mol. Its IUPAC name is N-ethyl-N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111496108 |
| Molecular Formula | C20H28N6S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-ethyl-N'-(2-phenylsulfanylpropyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)Sc1ccccc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H28N6S/c1-3-21-19(24-16-17(2)27-18-8-5-4-6-9-18)25-12-14-26(15-13-25)20-22-10-7-11-23-20/h4-11,17H,3,12-16H2,1-2H3,(H,21,24) |
| InChIKey | PFKQDZLCUGFWFJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|