C18H34IN7 — CID 111206429
N'-[2-(diethylamino)propyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111206429) has the molecular formula C18H34IN7 and a molecular weight of 475.42 g/mol. Its IUPAC name is N'-[2-(diethylamino)propyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(diethylamino)propyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111206429 |
| Molecular Formula | C18H34IN7 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N'-[2-(diethylamino)propyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N(CC)CC)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C18H33N7.HI/c1-5-19-17(22-15-16(4)23(6-2)7-3)24-11-13-25(14-12-24)18-20-9-8-10-21-18;/h8-10,16H,5-7,11-15H2,1-4H3,(H,19,22);1H |
| InChIKey | CROFKHUTMBKLLW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|