C17H22N6S — CID 119117550
N'-(2-phenylsulfanylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119117550) has the molecular formula C17H22N6S and a molecular weight of 342.47 g/mol. Its IUPAC name is N'-(2-phenylsulfanylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-(2-phenylsulfanylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119117550 |
| Molecular Formula | C17H22N6S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N'-(2-phenylsulfanylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\CCSc1ccccc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H22N6S/c18-16(19-9-14-24-15-5-2-1-3-6-15)22-10-12-23(13-11-22)17-20-7-4-8-21-17/h1-8H,9-14H2,(H2,18,19) |
| InChIKey | PLLKXWPQXUIKBF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|