C14H23N7O — CID 119117614
2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]-N-propan-2-ylacetamide (PubChem CID 119117614) has the molecular formula C14H23N7O and a molecular weight of 305.39 g/mol. Its IUPAC name is 2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 119117614 |
| Molecular Formula | C14H23N7O |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-[[amino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)C/N=C(\N)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H23N7O/c1-11(2)19-12(22)10-18-13(15)20-6-8-21(9-7-20)14-16-4-3-5-17-14/h3-5,11H,6-10H2,1-2H3,(H2,15,18)(H,19,22) |
| InChIKey | UULSDHJZUNUTFJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|