C16H27N7O2S — CID 119161148
N'-[[2-(methanesulfonamido)cyclopentyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 119161148) has the molecular formula C16H27N7O2S and a molecular weight of 381.51 g/mol. Its IUPAC name is N'-[[2-(methanesulfonamido)cyclopentyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[[2-(methanesulfonamido)cyclopentyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119161148 |
| Molecular Formula | C16H27N7O2S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N'-[[2-(methanesulfonamido)cyclopentyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CS(=O)(=O)NC1CCCC1C/N=C(\N)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H27N7O2S/c1-26(24,25)21-14-5-2-4-13(14)12-20-15(17)22-8-10-23(11-9-22)16-18-6-3-7-19-16/h3,6-7,13-14,21H,2,4-5,8-12H2,1H3,(H2,17,20) |
| InChIKey | ZMXIUQSMACNFOV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|